cas: 303041-88-5 — see every product listed under this CAS number, including other names
1-Boc-4-Bromo-3-formylindole 95% (CAS 303041-88-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A283318-5g |
| cas | 303041-88-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 687.44 Pln | |
| Ambeed | 25g | 1583.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A283318 |
Tert-butyl 4-bromo-3-formylindole-1-carboxylate (CAS 303041-88-5) is a chemical compound with the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. IUPAC name: tert-butyl 4-bromo-3-formylindole-1-carboxylate. InChIKey: URXQJQRVBNAQDT-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO3 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-formylindole-1-carboxylate |
| InChIKey | URXQJQRVBNAQDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC=C2Br)C=O |
Computed by PubChem (NCBI)