cas: 303041-88-5 — see every product listed under this CAS number, including other names
1-Boc-4-Bromo-3-formylindole, 95%, 95% (CAS 303041-88-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ZLP-250mg |
| cas | 303041-88-5 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 645.20 Pln | |
| Chemat | 10g | 1058.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-bromo-3-formylindole-1-carboxylate (CAS 303041-88-5) is a chemical compound with the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. IUPAC name: tert-butyl 4-bromo-3-formylindole-1-carboxylate. InChIKey: URXQJQRVBNAQDT-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO3 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | tert-butyl 4-bromo-3-formylindole-1-carboxylate |
| InChIKey | URXQJQRVBNAQDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC=C2Br)C=O |
Computed by PubChem (NCBI)