cas: 1207194-48-6 — see every product listed under this CAS number, including other names
1-Boc-4-formylindoline 97% (CAS 1207194-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A197639-100mg |
| cas | 1207194-48-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 960.00 Pln | |
| Ambeed | 5g | 3579.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A197639 |
Tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate (CAS 1207194-48-6) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate. InChIKey: FEAIDQMPFVVRKA-UHFFFAOYSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl 4-formyl-2,3-dihydroindole-1-carboxylate |
| InChIKey | FEAIDQMPFVVRKA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C=CC=C21)C=O |
Computed by PubChem (NCBI)