cas: 840481-77-8 — see every product listed under this CAS number, including other names
1-Boc-4-iodo-1H-imidazole, 97%, 97% (CAS 840481-77-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMBW-100mg |
| cas | 840481-77-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 755.60 Pln | |
| Chemat | 5g | 2363.60 Pln | |
| Chemat | 10g | 3362.00 Pln | |
| Chemat | 25g | 8162.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-iodoimidazole-1-carboxylate (CAS 840481-77-8) is a chemical compound with the molecular formula C8H11IN2O2 and a molecular weight of 294.09 g/mol. IUPAC name: tert-butyl 4-iodoimidazole-1-carboxylate. InChIKey: GRUJHCRLXRVGRX-UHFFFAOYSA-N.
| Molecular formula | C8H11IN2O2 |
|---|---|
| Molecular weight | 294.09 g/mol |
| IUPAC name | tert-butyl 4-iodoimidazole-1-carboxylate |
| InChIKey | GRUJHCRLXRVGRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(N=C1)I |
Computed by PubChem (NCBI)