Products 2900374-92-5

CAS 2900374-92-5 is the registry number for 2-(4-Iodo-5-methyl-1H-pyrazol-1-yl)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-iodo-5-methylpyrazol-1-yl)-2-methylpropanoic acid (CAS 2900374-92-5) is a chemical compound with the molecular formula C8H11IN2O2 and a molecular weight of 294.09 g/mol. IUPAC name: 2-(4-iodo-5-methylpyrazol-1-yl)-2-methylpropanoic acid. InChIKey: BLCKWXSEVRMVIY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11IN2O2
Molecular weight294.09 g/mol
IUPAC name2-(4-iodo-5-methylpyrazol-1-yl)-2-methylpropanoic acid
InChIKeyBLCKWXSEVRMVIY-UHFFFAOYSA-N
SMILESCC1=C(C=NN1C(C)(C)C(=O)O)I

Computed by PubChem (NCBI)