Products 1820620-00-5
CAS 1820620-00-5 appears in our catalog under these names: 3-Iodo-5-methyl-pyridin-2-ylamine acetate, 95%, 3-Iodo-5-methyl-pyridin-2-ylamine acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Acetic acid;3-iodo-5-methylpyridin-2-amine (CAS 1820620-00-5) is a chemical compound with the molecular formula C8H11IN2O2 and a molecular weight of 294.09 g/mol. IUPAC name: acetic acid;3-iodo-5-methylpyridin-2-amine. InChIKey: GHRUHMGZYWNQPU-UHFFFAOYSA-N.
| Molecular formula | C8H11IN2O2 |
|---|---|
| Molecular weight | 294.09 g/mol |
| IUPAC name | acetic acid;3-iodo-5-methylpyridin-2-amine |
| InChIKey | GHRUHMGZYWNQPU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)N)I.CC(=O)O |
Computed by PubChem (NCBI)