cas: 630110-71-3 — see every product listed under this CAS number, including other names
1-Boc-6-benzyloxy-3-formylindole, 95% (CAS 630110-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076616-100MG |
| cas | 630110-71-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2132.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-formyl-6-phenylmethoxyindole-1-carboxylate (CAS 630110-71-3) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: tert-butyl 3-formyl-6-phenylmethoxyindole-1-carboxylate. InChIKey: BIGAKQBLDWFYEU-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | tert-butyl 3-formyl-6-phenylmethoxyindole-1-carboxylate |
| InChIKey | BIGAKQBLDWFYEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)OCC3=CC=CC=C3)C=O |
Computed by PubChem (NCBI)