CAS 1219163-22-0 appears in our catalog under these names: 3-Cyclopropyl-2-(9h-fluoren-9-ylmethoxycarbonylamino)-propionic acid, 95%, Fmoc–3–Cyclopropylalanine, N-FMOC-Cyclopropyl alanine, Fmoc-DL-Ala(cPr)-OH 97%, 3-Cyclopropyl-2-(9h-fluoren-9-ylmethoxycarbonylamino)-propionic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 0,5g, 50mg, 100mg, 25mg, 250mg.
3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1219163-22-0) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: 3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: DRGUEWQZLABTFG-UHFFFAOYSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 3-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | DRGUEWQZLABTFG-UHFFFAOYSA-N |
| SMILES | C1CC1CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)