cas: 187834-88-4 — see every product listed under this CAS number, including other names
1-Boc-Isonipecotic acid hydrazide, 97% (CAS 187834-88-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236613-1G |
| cas | 187834-88-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 393.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate (CAS 187834-88-4) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate. InChIKey: JLIKTOWFNQDEME-UHFFFAOYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl 4-(hydrazinecarbonyl)piperidine-1-carboxylate |
| InChIKey | JLIKTOWFNQDEME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(=O)NN |
Computed by PubChem (NCBI)