cas: 159877-36-8 — see every product listed under this CAS number, including other names
1-Boc-Octahydropyrrolo[3,4-b]pyridine, 95% (CAS 159877-36-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076049-250MG |
| cas | 159877-36-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2658.46 Pln | |
| Fluorochem | 10g | 5058.65 Pln | |
| Fluorochem | 25g | 10525.48 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate (CAS 159877-36-8) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate. InChIKey: LGEWGFOMLJQHLL-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine-1-carboxylate |
| InChIKey | LGEWGFOMLJQHLL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2C1CNC2 |
Computed by PubChem (NCBI)