CAS 1420800-30-1 is the registry number for 1-Bromo-2,4-difluoro-3-nitrobenzene, 98%. Offered by: Fluorochem. Available pack sizes: 10g.
1-bromo-2,4-difluoro-3-nitrobenzene (CAS 1420800-30-1) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 1-bromo-2,4-difluoro-3-nitrobenzene. InChIKey: OZKHXLKTMAVPFF-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO2 |
|---|---|
| Molecular weight | 237.99 g/mol |
| IUPAC name | 1-bromo-2,4-difluoro-3-nitrobenzene |
| InChIKey | OZKHXLKTMAVPFF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)