CAS 321-17-5 appears in our catalog under these names: 1–bromo–4,5–difluoro–2–nitrobenzene, 1-Bromo-4,5-difluoro-2-nitrobenzene 98%, 1-Bromo-4,5-difluoro-2-nitrobenzene, 98%, 98%, 2-Bromo-4,5-difluoronitrobenzene, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
1-bromo-4,5-difluoro-2-nitrobenzene (CAS 321-17-5) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 1-bromo-4,5-difluoro-2-nitrobenzene. InChIKey: UWPUJVOSEQMMQE-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO2 |
|---|---|
| Molecular weight | 237.99 g/mol |
| IUPAC name | 1-bromo-4,5-difluoro-2-nitrobenzene |
| InChIKey | UWPUJVOSEQMMQE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)