CAS 374633-24-6 appears in our catalog under these names: 3-Bromo-4,5-difluoronitrobenzene, 1-Bromo-2,3-difluoro-5-nitrobenzene 95%, 3-Bromo-4,5-difluoronitrobenzene, 97%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g, 100g.
1-bromo-2,3-difluoro-5-nitrobenzene (CAS 374633-24-6) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 1-bromo-2,3-difluoro-5-nitrobenzene. InChIKey: MGMBTDXCNDOKOP-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF2NO2 |
|---|---|
| Molecular weight | 237.99 g/mol |
| IUPAC name | 1-bromo-2,3-difluoro-5-nitrobenzene |
| InChIKey | MGMBTDXCNDOKOP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)