cas: 261945-75-9 — see every product listed under this CAS number, including other names
1-Bromo-2,5-difluoro-4-(trifluoromethyl)benzene (CAS 261945-75-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F098290-100MG |
| cas | 261945-75-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 1549.47 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-2,5-difluoro-4-(trifluoromethyl)benzene (CAS 261945-75-9) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-2,5-difluoro-4-(trifluoromethyl)benzene. InChIKey: FRNCYVHNJMSHKX-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-2,5-difluoro-4-(trifluoromethyl)benzene |
| InChIKey | FRNCYVHNJMSHKX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)C(F)(F)F |
Computed by PubChem (NCBI)