CAS 1805023-67-9 is the registry number for 3-Bromo-2,4-difluorobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-bromo-1,3-difluoro-4-(trifluoromethyl)benzene (CAS 1805023-67-9) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 2-bromo-1,3-difluoro-4-(trifluoromethyl)benzene. InChIKey: POKCXYBEECQWEG-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 2-bromo-1,3-difluoro-4-(trifluoromethyl)benzene |
| InChIKey | POKCXYBEECQWEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)Br)F |
Computed by PubChem (NCBI)