Products 112290-04-7
CAS 112290-04-7 appears in our catalog under these names: 2-Bromo-4,5-difluorobenzotrifluoride, 95%, 2-Bromo-4,5-difluorobenzotrifluoride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g.
1-bromo-4,5-difluoro-2-(trifluoromethyl)benzene (CAS 112290-04-7) is a chemical compound with the molecular formula C7H2BrF5 and a molecular weight of 260.99 g/mol. IUPAC name: 1-bromo-4,5-difluoro-2-(trifluoromethyl)benzene. InChIKey: RYRRQLCTAKISEA-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF5 |
|---|---|
| Molecular weight | 260.99 g/mol |
| IUPAC name | 1-bromo-4,5-difluoro-2-(trifluoromethyl)benzene |
| InChIKey | RYRRQLCTAKISEA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)Br)C(F)(F)F |
Computed by PubChem (NCBI)