cas: 2150186-49-3 — see every product listed under this CAS number, including other names
1-Bromo-2-(methoxymethoxy)-4-(trifluoromethyl)benzene (CAS 2150186-49-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629659-1G |
| cas | 2150186-49-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2752.17 Pln | |
| Fluorochem | 5g | 8109.66 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-2-(methoxymethoxy)-4-(trifluoromethyl)benzene (CAS 2150186-49-3) is a chemical compound with the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. IUPAC name: 1-bromo-2-(methoxymethoxy)-4-(trifluoromethyl)benzene. InChIKey: NCDHFFIVRMJGQI-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O2 |
|---|---|
| Molecular weight | 285.06 g/mol |
| IUPAC name | 1-bromo-2-(methoxymethoxy)-4-(trifluoromethyl)benzene |
| InChIKey | NCDHFFIVRMJGQI-UHFFFAOYSA-N |
| SMILES | COCOC1=C(C=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)