CAS 1342107-04-3 is the registry number for (3-Bromo-4-(2,2,2-trifluoroethoxy)phenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]methanol (CAS 1342107-04-3) is a chemical compound with the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. IUPAC name: [3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]methanol. InChIKey: POWFEPPZYROWRZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O2 |
|---|---|
| Molecular weight | 285.06 g/mol |
| IUPAC name | [3-bromo-4-(2,2,2-trifluoroethoxy)phenyl]methanol |
| InChIKey | POWFEPPZYROWRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CO)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)