cas: 1804382-22-6 — see every product listed under this CAS number, including other names
1-Bromo-2-chloro-3-fluoro-4-nitrobenzene 95+% (CAS 1804382-22-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A248750-100mg |
| cas | 1804382-22-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 754.19 Pln | |
| Ambeed | 250mg | 1366.06 Pln | |
| Ambeed | 1g | 3134.94 Pln | |
| Ambeed | 5g | 7618.31 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A248750 |
1-bromo-2-chloro-3-fluoro-4-nitrobenzene (CAS 1804382-22-6) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 1-bromo-2-chloro-3-fluoro-4-nitrobenzene. InChIKey: WZNRZCUIFMKTCC-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 1-bromo-2-chloro-3-fluoro-4-nitrobenzene |
| InChIKey | WZNRZCUIFMKTCC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)Cl)Br |
Computed by PubChem (NCBI)