CAS 1805575-94-3 is the registry number for 1-Bromo-2-chloro-4-fluoro-3-nitrobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-bromo-2-chloro-4-fluoro-3-nitrobenzene (CAS 1805575-94-3) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 1-bromo-2-chloro-4-fluoro-3-nitrobenzene. InChIKey: QWYYHPXBAHLFAN-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 1-bromo-2-chloro-4-fluoro-3-nitrobenzene |
| InChIKey | QWYYHPXBAHLFAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)