Products 514798-01-7
CAS 514798-01-7 appears in our catalog under these names: 2-Bromo-5-chloro-3-fluoroisonicotinic acid, 96%, 2-Bromo-5-chloro-3-fluoroisonicotinic acid, 98%, 2-Bromo-5-chloro-3-fluoroisonicotinic acid, 98%, 98%, 2-Bromo-5-chloro-3-fluoroisonicotinic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
2-bromo-5-chloro-3-fluoropyridine-4-carboxylic acid (CAS 514798-01-7) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 2-bromo-5-chloro-3-fluoropyridine-4-carboxylic acid. InChIKey: QRVYYWFRDLOAQR-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 2-bromo-5-chloro-3-fluoropyridine-4-carboxylic acid |
| InChIKey | QRVYYWFRDLOAQR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Br)F)C(=O)O)Cl |
Computed by PubChem (NCBI)