cas: 1935326-93-4 — see every product listed under this CAS number, including other names
1-Bromo-2-chloro-3-thiocyanatobenzene 95% (CAS 1935326-93-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A757520-250mg |
| cas | 1935326-93-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 681.88 Pln | |
| Ambeed | 1g | 1293.75 Pln | |
| Ambeed | 5g | 4547.81 Pln | |
| Ambeed | 10g | 7940.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A757520 |
(3-bromo-2-chlorophenyl) thiocyanate (CAS 1935326-93-4) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: (3-bromo-2-chlorophenyl) thiocyanate. InChIKey: NKXXEIMIRZQQFT-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | (3-bromo-2-chlorophenyl) thiocyanate |
| InChIKey | NKXXEIMIRZQQFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)SC#N |
Computed by PubChem (NCBI)