Products 1315360-86-1
CAS 1315360-86-1 appears in our catalog under these names: 3-Bromo-7-chlorothieno[2,3-c]pyridine, 95%, 3-Bromo-7-chlorothieno(2,3-c)pyridine, 97%, 3-bromo-7-chlorothieno(2,3-c)pyridine, 3-bromo-7-chlorothieno[2,3-c]pyridine, 95%, 95%, 3-BROMO-7-CHLOROTHIENO[2,3-C]PYRIDINE, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 0,5g, 50mg, 100mg, 500mg.
3-bromo-7-chlorothieno[2,3-c]pyridine (CAS 1315360-86-1) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: 3-bromo-7-chlorothieno[2,3-c]pyridine. InChIKey: SJCZRKWLMNKKIP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | 3-bromo-7-chlorothieno[2,3-c]pyridine |
| InChIKey | SJCZRKWLMNKKIP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=CS2)Br)Cl |
Computed by PubChem (NCBI)