CAS 1935326-93-4 appears in our catalog under these names: 1-Bromo-2-chloro-3-thiocyanato-benzene, 95%, 1-Bromo-2-chloro-3-thiocyanatobenzene 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg.
(3-bromo-2-chlorophenyl) thiocyanate (CAS 1935326-93-4) is a chemical compound with the molecular formula C7H3BrClNS and a molecular weight of 248.53 g/mol. IUPAC name: (3-bromo-2-chlorophenyl) thiocyanate. InChIKey: NKXXEIMIRZQQFT-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNS |
|---|---|
| Molecular weight | 248.53 g/mol |
| IUPAC name | (3-bromo-2-chlorophenyl) thiocyanate |
| InChIKey | NKXXEIMIRZQQFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)SC#N |
Computed by PubChem (NCBI)