1-Bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene, 95%
cas: 1784088-25-0 — see every product listed under this CAS number, including other names
1-Bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene, 95% (CAS 1784088-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1473921-100mg |
| cas | 1784088-25-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 948.88 Pln | |
| Ambeed | 250mg | 1827.75 Pln | |
| Ambeed | 1g | 5337.69 Pln | |
| BLDpharm | 50mg | 630.91 Pln | |
| BLDpharm | 100mg | 1019.67 Pln | |
| BLDpharm | 250mg | 1963.78 Pln | |
| BLDpharm | 1g | 5751.33 Pln | |
| Chemat | 100mg | 746.00 Pln | |
| Chemat | 250mg | 1432.40 Pln | |
| Chemat | 1g | 4173.20 Pln | |
| Fluorochem | 100mg | 1382.86 Pln | |
| Fluorochem | 1g | 7599.43 Pln | |
| Fluorochem | 250mg | 2663.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene (CAS 1784088-25-0) is a chemical compound with the molecular formula C10H10BrFO and a molecular weight of 245.09 g/mol. IUPAC name: 1-bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene. InChIKey: VFKDCQKJYRZZFO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 1-bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene |
| InChIKey | VFKDCQKJYRZZFO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)Br)C2CC2)F |
Computed by PubChem (NCBI)