Products 1784088-25-0
CAS 1784088-25-0 is the registry number for 1-Bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg.
1-bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene (CAS 1784088-25-0) is a chemical compound with the molecular formula C10H10BrFO and a molecular weight of 245.09 g/mol. IUPAC name: 1-bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene. InChIKey: VFKDCQKJYRZZFO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 1-bromo-2-cyclopropyl-4-fluoro-5-methoxybenzene |
| InChIKey | VFKDCQKJYRZZFO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)Br)C2CC2)F |
Computed by PubChem (NCBI)