CAS 1156170-01-2 appears in our catalog under these names: 4-Fluoro-2-bromophenol methylcyclopropyl ether, 2-Bromo-1-(cyclopropylmethoxy)-4-fluorobenzene, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 1g.
2-bromo-1-(cyclopropylmethoxy)-4-fluorobenzene (CAS 1156170-01-2) is a chemical compound with the molecular formula C10H10BrFO and a molecular weight of 245.09 g/mol. IUPAC name: 2-bromo-1-(cyclopropylmethoxy)-4-fluorobenzene. InChIKey: DMBRHDBGDYLULL-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 2-bromo-1-(cyclopropylmethoxy)-4-fluorobenzene |
| InChIKey | DMBRHDBGDYLULL-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=C(C=C2)F)Br |
Computed by PubChem (NCBI)