cas: 1226808-77-0 — see every product listed under this CAS number, including other names
1-Bromo-2-fluoro-4-iodo-5-nitrobenzene 98% (CAS 1226808-77-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A406510-1g |
| cas | 1226808-77-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 731.94 Pln | |
| Ambeed | 25g | 2333.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A406510 |
1-bromo-2-fluoro-4-iodo-5-nitrobenzene (CAS 1226808-77-0) is a chemical compound with the molecular formula C6H2BrFINO2 and a molecular weight of 345.89 g/mol. IUPAC name: 1-bromo-2-fluoro-4-iodo-5-nitrobenzene. InChIKey: BNZPOZOFBGRDLL-UHFFFAOYSA-N.
| Molecular formula | C6H2BrFINO2 |
|---|---|
| Molecular weight | 345.89 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-iodo-5-nitrobenzene |
| InChIKey | BNZPOZOFBGRDLL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)