CAS 144580-17-6 is the registry number for 1-bromo-5-fluoro-2-iodo-3-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-bromo-5-fluoro-2-iodo-3-nitrobenzene (CAS 144580-17-6) is a chemical compound with the molecular formula C6H2BrFINO2 and a molecular weight of 345.89 g/mol. IUPAC name: 1-bromo-5-fluoro-2-iodo-3-nitrobenzene. InChIKey: FCTQLTWMQHZGJK-UHFFFAOYSA-N.
| Molecular formula | C6H2BrFINO2 |
|---|---|
| Molecular weight | 345.89 g/mol |
| IUPAC name | 1-bromo-5-fluoro-2-iodo-3-nitrobenzene |
| InChIKey | FCTQLTWMQHZGJK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])I)Br)F |
Computed by PubChem (NCBI)