CAS 1226808-77-0 appears in our catalog under these names: 1-Bromo-2-fluoro-4-iodo-5-nitrobenzene, 96%, 1-Bromo-2-fluoro-4-iodo-5-nitrobenzene 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
1-bromo-2-fluoro-4-iodo-5-nitrobenzene (CAS 1226808-77-0) is a chemical compound with the molecular formula C6H2BrFINO2 and a molecular weight of 345.89 g/mol. IUPAC name: 1-bromo-2-fluoro-4-iodo-5-nitrobenzene. InChIKey: BNZPOZOFBGRDLL-UHFFFAOYSA-N.
| Molecular formula | C6H2BrFINO2 |
|---|---|
| Molecular weight | 345.89 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-iodo-5-nitrobenzene |
| InChIKey | BNZPOZOFBGRDLL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)