cas: 1204333-52-7 — see every product listed under this CAS number, including other names
1-Bromo-3-(difluoromethyl)-2-fluorobenzene, 95+%, 95+% (CAS 1204333-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12B7NT-100mg |
| cas | 1204333-52-7 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 10g | 342.80 Pln | |
| Chemat | 25g | 664.40 Pln | |
| Chemat | 100g | 1826.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-(difluoromethyl)-2-fluorobenzene (CAS 1204333-52-7) is a chemical compound with the molecular formula C7H4BrF3 and a molecular weight of 225.01 g/mol. IUPAC name: 1-bromo-3-(difluoromethyl)-2-fluorobenzene. InChIKey: MFYNCTJUIOMWME-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3 |
|---|---|
| Molecular weight | 225.01 g/mol |
| IUPAC name | 1-bromo-3-(difluoromethyl)-2-fluorobenzene |
| InChIKey | MFYNCTJUIOMWME-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(F)F |
Computed by PubChem (NCBI)