cas: 1204333-52-7 — see every product listed under this CAS number, including other names
1-Bromo-3-(difluoromethyl)-2-fluorobenzene, 98% (CAS 1204333-52-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F099969-250MG |
| cas | 1204333-52-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 518.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-3-(difluoromethyl)-2-fluorobenzene (CAS 1204333-52-7) is a chemical compound with the molecular formula C7H4BrF3 and a molecular weight of 225.01 g/mol. IUPAC name: 1-bromo-3-(difluoromethyl)-2-fluorobenzene. InChIKey: MFYNCTJUIOMWME-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3 |
|---|---|
| Molecular weight | 225.01 g/mol |
| IUPAC name | 1-bromo-3-(difluoromethyl)-2-fluorobenzene |
| InChIKey | MFYNCTJUIOMWME-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)C(F)F |
Computed by PubChem (NCBI)