cas: 152840-71-6 — see every product listed under this CAS number, including other names
1-Bromo-3-chloro-2,4,5-trifluorobenzene 95% (CAS 152840-71-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A986446-1g |
| cas | 152840-71-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 965.56 Pln | |
| Ambeed | 25g | 3296.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A986446 |
1-bromo-3-chloro-2,4,5-trifluorobenzene (CAS 152840-71-6) is a chemical compound with the molecular formula C6HBrClF3 and a molecular weight of 245.42 g/mol. IUPAC name: 1-bromo-3-chloro-2,4,5-trifluorobenzene. InChIKey: VYULIZVZKXJRMU-UHFFFAOYSA-N.
| Molecular formula | C6HBrClF3 |
|---|---|
| Molecular weight | 245.42 g/mol |
| IUPAC name | 1-bromo-3-chloro-2,4,5-trifluorobenzene |
| InChIKey | VYULIZVZKXJRMU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)Cl)F)F |
Computed by PubChem (NCBI)