cas: 1330583-70-4 — see every product listed under this CAS number, including other names
1-Bromo-3-chloro-2-fluoro-5-nitrobenzene, 97%, 97% (CAS 1330583-70-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HSQI-100mg |
| cas | 1330583-70-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Chemat | 5g | 3635.60 Pln | |
| Chemat | 10g | 5781.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-chloro-2-fluoro-5-nitrobenzene (CAS 1330583-70-4) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 1-bromo-3-chloro-2-fluoro-5-nitrobenzene. InChIKey: BRRBPBANQLIPKD-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 1-bromo-3-chloro-2-fluoro-5-nitrobenzene |
| InChIKey | BRRBPBANQLIPKD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)