cas: 875664-36-1 — see every product listed under this CAS number, including other names
1-Bromo-3-fluoro-2-methoxy-5-nitrobenzene 97% (CAS 875664-36-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A909685-1g |
| cas | 875664-36-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 932.19 Pln | |
| Ambeed | 100g | 2856.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A909685 |
1-bromo-3-fluoro-2-methoxy-5-nitrobenzene (CAS 875664-36-1) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 1-bromo-3-fluoro-2-methoxy-5-nitrobenzene. InChIKey: FNJMNFQCIBHJBZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 1-bromo-3-fluoro-2-methoxy-5-nitrobenzene |
| InChIKey | FNJMNFQCIBHJBZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)