cas: 875664-36-1 — see every product listed under this CAS number, including other names
1-Bromo-3-fluoro-2-methoxy-5-nitrobenzene, 98%, 98% (CAS 875664-36-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115ME0-100mg |
| cas | 875664-36-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 10g | 558.80 Pln | |
| Chemat | 25g | 952.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-fluoro-2-methoxy-5-nitrobenzene (CAS 875664-36-1) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 1-bromo-3-fluoro-2-methoxy-5-nitrobenzene. InChIKey: FNJMNFQCIBHJBZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 1-bromo-3-fluoro-2-methoxy-5-nitrobenzene |
| InChIKey | FNJMNFQCIBHJBZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)