cas: 845866-78-6 — see every product listed under this CAS number, including other names
1-Bromo-3-iodo-5-(trifluoromethoxy)benzene 95% (CAS 845866-78-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A886759-250mg |
| cas | 845866-78-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 1076.81 Pln | |
| Ambeed | 10g | 1421.69 Pln | |
| Ambeed | 25g | 3440.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A886759 |
1-bromo-3-iodo-5-(trifluoromethoxy)benzene (CAS 845866-78-6) is a chemical compound with the molecular formula C7H3BrF3IO and a molecular weight of 366.90 g/mol. IUPAC name: 1-bromo-3-iodo-5-(trifluoromethoxy)benzene. InChIKey: SJEYHNDEVIRTLB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3IO |
|---|---|
| Molecular weight | 366.90 g/mol |
| IUPAC name | 1-bromo-3-iodo-5-(trifluoromethoxy)benzene |
| InChIKey | SJEYHNDEVIRTLB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)I)OC(F)(F)F |
Computed by PubChem (NCBI)