cas: 845866-78-6 — see every product listed under this CAS number, including other names
1-Bromo-3-iodo-5-(trifluoromethoxy)benzene (CAS 845866-78-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023860-250MG |
| cas | 845866-78-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 10g | 3252.00 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-3-iodo-5-(trifluoromethoxy)benzene (CAS 845866-78-6) is a chemical compound with the molecular formula C7H3BrF3IO and a molecular weight of 366.90 g/mol. IUPAC name: 1-bromo-3-iodo-5-(trifluoromethoxy)benzene. InChIKey: SJEYHNDEVIRTLB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3IO |
|---|---|
| Molecular weight | 366.90 g/mol |
| IUPAC name | 1-bromo-3-iodo-5-(trifluoromethoxy)benzene |
| InChIKey | SJEYHNDEVIRTLB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)I)OC(F)(F)F |
Computed by PubChem (NCBI)