cas: 845866-78-6 — see every product listed under this CAS number, including other names
1-Bromo-3-iodo-5-(trifluoromethoxy)benzene, 98%, 98% (CAS 845866-78-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G582-1g |
| cas | 845866-78-6 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 304.40 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 5g | 1154.00 Pln | |
| Chemat | 10g | 1979.60 Pln | |
| Chemat | 25g | 3899.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-3-iodo-5-(trifluoromethoxy)benzene (CAS 845866-78-6) is a chemical compound with the molecular formula C7H3BrF3IO and a molecular weight of 366.90 g/mol. IUPAC name: 1-bromo-3-iodo-5-(trifluoromethoxy)benzene. InChIKey: SJEYHNDEVIRTLB-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3IO |
|---|---|
| Molecular weight | 366.90 g/mol |
| IUPAC name | 1-bromo-3-iodo-5-(trifluoromethoxy)benzene |
| InChIKey | SJEYHNDEVIRTLB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)I)OC(F)(F)F |
Computed by PubChem (NCBI)