cas: 104202-15-5 — see every product listed under this CAS number, including other names
1-Bromo-3-phenylimidazo(1,5-a)pyridine, 95+% (CAS 104202-15-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A672008-10g |
| cas | 104202-15-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 7999.18 Pln | |
| AmBeed | 250mg | 766.57 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-bromo-3-phenylimidazo[1,5-a]pyridine (CAS 104202-15-5) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 1-bromo-3-phenylimidazo[1,5-a]pyridine. InChIKey: ULKZZBGVTIZXSA-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 1-bromo-3-phenylimidazo[1,5-a]pyridine |
| InChIKey | ULKZZBGVTIZXSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C3N2C=CC=C3)Br |
Computed by PubChem (NCBI)