Products 85750-24-9
CAS 85750-24-9 appears in our catalog under these names: Brompheniramine Impurity 3, Alpha-(4-Bromophenyl)-2-pyridineacetonitrile, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 5g.
2-(4-bromophenyl)-2-pyridin-2-ylacetonitrile (CAS 85750-24-9) is a chemical compound with the molecular formula C13H9BrN2 and a molecular weight of 273.13 g/mol. IUPAC name: 2-(4-bromophenyl)-2-pyridin-2-ylacetonitrile. InChIKey: PMKCUNAECONNCQ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2 |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-pyridin-2-ylacetonitrile |
| InChIKey | PMKCUNAECONNCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(C#N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)