cas: 21969-04-0 — see every product listed under this CAS number, including other names
1-Bromo-4-(4-nitrophenoxy)benzene 95% (CAS 21969-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A613562-250mg |
| cas | 21969-04-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2372.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A613562 |
1-(4-bromophenoxy)-4-nitrobenzene (CAS 21969-04-0) is a chemical compound with the molecular formula C12H8BrNO3 and a molecular weight of 294.10 g/mol. IUPAC name: 1-(4-bromophenoxy)-4-nitrobenzene. InChIKey: MGYQHRSVAWPHIL-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO3 |
|---|---|
| Molecular weight | 294.10 g/mol |
| IUPAC name | 1-(4-bromophenoxy)-4-nitrobenzene |
| InChIKey | MGYQHRSVAWPHIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)