cas: 21969-04-0 — see every product listed under this CAS number, including other names
1-Bromo-4-(4-nitrophenoxy)benzene, 95%, 95% (CAS 21969-04-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BED9-250mg |
| cas | 21969-04-0 |
| size | 250mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1307.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenoxy)-4-nitrobenzene (CAS 21969-04-0) is a chemical compound with the molecular formula C12H8BrNO3 and a molecular weight of 294.10 g/mol. IUPAC name: 1-(4-bromophenoxy)-4-nitrobenzene. InChIKey: MGYQHRSVAWPHIL-UHFFFAOYSA-N.
| Molecular formula | C12H8BrNO3 |
|---|---|
| Molecular weight | 294.10 g/mol |
| IUPAC name | 1-(4-bromophenoxy)-4-nitrobenzene |
| InChIKey | MGYQHRSVAWPHIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)