CAS 56131-47-6 appears in our catalog under these names: 3–Bromo–2–chlorobenzotrifluoride, 1-Bromo-2-chloro-3-(trifluoromethyl)benzene 98+%, 1-Bromo-2-chloro-3-(trifluoromethyl)benzene 97%, 1-Bromo-2-chloro-3-(trifluoromethyl),benzene, 97%, 97%, 1-Bromo-2-chloro-3-(trifluoromethyl)benzene, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 500g, 250mg, 1g, 10g, 100mg.
1-bromo-2-chloro-3-(trifluoromethyl)benzene (CAS 56131-47-6) is a chemical compound with the molecular formula C7H3BrClF3 and a molecular weight of 259.45 g/mol. IUPAC name: 1-bromo-2-chloro-3-(trifluoromethyl)benzene. InChIKey: DWTJMEQXGJMZMM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3 |
|---|---|
| Molecular weight | 259.45 g/mol |
| IUPAC name | 1-bromo-2-chloro-3-(trifluoromethyl)benzene |
| InChIKey | DWTJMEQXGJMZMM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)C(F)(F)F |
Computed by PubChem (NCBI)