CAS 1520589-57-4 appears in our catalog under these names: 1-Bromo-2-(chloromethyl)-3,4,5-trifluorobenzene, 95%, 1-Bromo-2-(chloromethyl)-3,4,5-trifluorobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-bromo-2-(chloromethyl)-3,4,5-trifluorobenzene (CAS 1520589-57-4) is a chemical compound with the molecular formula C7H3BrClF3 and a molecular weight of 259.45 g/mol. IUPAC name: 1-bromo-2-(chloromethyl)-3,4,5-trifluorobenzene. InChIKey: CRUROJDBDNJGEL-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3 |
|---|---|
| Molecular weight | 259.45 g/mol |
| IUPAC name | 1-bromo-2-(chloromethyl)-3,4,5-trifluorobenzene |
| InChIKey | CRUROJDBDNJGEL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)CCl)F)F)F |
Computed by PubChem (NCBI)