cas: 1806970-78-4 — see every product listed under this CAS number, including other names
1-Bromo-4-chloro-2-fluoro-3-nitrobenzene, 98% (CAS 1806970-78-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A709850-5g |
| cas | 1806970-78-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9548.56 Pln | |
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 250mg | 794.53 Pln | |
| Fluorochem | 1g | 1559.89 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-bromo-4-chloro-2-fluoro-3-nitrobenzene (CAS 1806970-78-4) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 1-bromo-4-chloro-2-fluoro-3-nitrobenzene. InChIKey: UTFRFVXKHJBCTB-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 1-bromo-4-chloro-2-fluoro-3-nitrobenzene |
| InChIKey | UTFRFVXKHJBCTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)