cas: 1311197-88-2 — see every product listed under this CAS number, including other names
1-Bromo-4-chloro-2-fluoro-5-nitrobenzene, 98%, 98% (CAS 1311197-88-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111VJV-250mg |
| cas | 1311197-88-2 |
| size | 250mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 100g | 1365.20 Pln | |
| Chemat | 500g | 5337.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-chloro-2-fluoro-5-nitrobenzene (CAS 1311197-88-2) is a chemical compound with the molecular formula C6H2BrClFNO2 and a molecular weight of 254.44 g/mol. IUPAC name: 1-bromo-4-chloro-2-fluoro-5-nitrobenzene. InChIKey: QVJCDJCNCFFOIC-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClFNO2 |
|---|---|
| Molecular weight | 254.44 g/mol |
| IUPAC name | 1-bromo-4-chloro-2-fluoro-5-nitrobenzene |
| InChIKey | QVJCDJCNCFFOIC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)