Products 1160573-48-7
CAS 1160573-48-7 is the registry number for 1-Bromo-4-chloro-3-methyl-2-nitrobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
1-bromo-4-chloro-3-methyl-2-nitrobenzene (CAS 1160573-48-7) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 1-bromo-4-chloro-3-methyl-2-nitrobenzene. InChIKey: RDBOWXCEEGEMBL-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 1-bromo-4-chloro-3-methyl-2-nitrobenzene |
| InChIKey | RDBOWXCEEGEMBL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1[N+](=O)[O-])Br)Cl |
Computed by PubChem (NCBI)