Products 1935399-77-1

CAS 1935399-77-1 is the registry number for 4-Amino-5-bromo-2-chloro-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-amino-5-bromo-2-chlorobenzoic acid (CAS 1935399-77-1) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 4-amino-5-bromo-2-chlorobenzoic acid. InChIKey: XCONKKMQGXDUHR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BrClNO2
Molecular weight250.48 g/mol
IUPAC name4-amino-5-bromo-2-chlorobenzoic acid
InChIKeyXCONKKMQGXDUHR-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Br)N)Cl)C(=O)O

Computed by PubChem (NCBI)