CAS 1340518-19-5 appears in our catalog under these names: 2-Amino-6-bromo-3-chlorobenzoic acid, 95%, 2-Amino-6-bromo-3-chlorobenzoic Acid, 2-Amino-6-bromo-3-chlorobenzoic Acid, 97+%, 97+%, 2-Amino-6-bromo-3-chlorobenzoic acid, 97+%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 0,5g, 250mg.
2-amino-6-bromo-3-chlorobenzoic acid (CAS 1340518-19-5) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 2-amino-6-bromo-3-chlorobenzoic acid. InChIKey: TZHCKHYMRRCAKE-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 2-amino-6-bromo-3-chlorobenzoic acid |
| InChIKey | TZHCKHYMRRCAKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)N)C(=O)O)Br |
Computed by PubChem (NCBI)